868272-85-9
| Name | DAB 4HCl |
| CAS | 868272-85-9 |
| EINECS(EC#) | 231-018-9 |
| Molecular Formula | C12H14N4 4HCl xH2O |
| MDL Number | MFCD08273058 |
| Molecular Weight | 268.75 |
| MOL File | 868272-85-9.mol |
Chemical Properties
| Appearance | Grey to brownish-purple crystalline powder |
| Melting point | 300°C |
| storage temp. | Freezer (-20°C) |
| solubility | H2O: soluble50mg/mL |
| form | Powder |
| color | White to Amber to Dark purple |
| Water Solubility | Soluble at 5%(w/v) in water |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C12H14N4.ClH.H2O/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;/h1-6H,13-16H2;1H;1H2 |
| InChIKey | YOEDEMAWKGDBAW-UHFFFAOYSA-N |
| SMILES | NC1=C(C=CC(C2C=CC(N)=C(N)C=2)=C1)N.Cl.O |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H341-H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DV8753000 |
| TSCA | Yes |
| HS Code | 29215900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Muta. 2 |