
7411-49-6
| Name | 3,3',4,4'-Biphenyltetramine tetrahydrochloride |
| CAS | 7411-49-6 |
| EINECS(EC#) | 231-018-9 |
| Molecular Formula | C12H18Cl4N4 |
| MDL Number | MFCD00012969 |
| Molecular Weight | 360.11 |
| MOL File | 7411-49-6.mol |
Chemical Properties
| Appearance | Grey Solid |
| Melting point | 300°C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | tablets |
| color | Crystals |
| PH | pH(25℃) : 7.4~7.8 |
| Water Solubility | Soluble |
| Sensitive | Moisture Sensitive/Air Sensitive |
| Usage | A substrate for peroxidase, and a reagent for the spectrophotometric determination of selenium |
| BRN | 1212988 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H14N4.4ClH/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;;;/h1-6H,13-16H2;4*1H |
| InChIKey | KJDSORYAHBAGPP-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N)C(N)=C2)=CC=C(N)C(N)=C1.[H]Cl.[H]Cl.[H]Cl.[H]Cl |
| CAS DataBase Reference | 7411-49-6(CAS DataBase Reference) |
| EPA Substance Registry System | 7411-49-6(EPA Substance) |
Safety Data
| Hazard Codes | F,T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3316 9/PG 2 |
| WGK Germany | 3 |
| RTECS | DV8753000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Muta. 2 |
| Hazardous Substances Data | 7411-49-6(Hazardous Substances Data) |
| Toxicity |