1883-09-6
| Name | L-2,4-Diaminobutyric acid dihydrochloride |
| CAS | 1883-09-6 |
| EINECS(EC#) | 217-542-0 |
| Molecular Formula | C4H12Cl2N2O2 |
| MDL Number | MFCD01632031 |
| Molecular Weight | 191.06 |
| MOL File | 1883-09-6.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 197-200 °C (dec.) |
| alpha | 14 º (c=3.7, H2O 16 ºC) |
| refractive index | 14.5 ° (C=3.6, H2O) |
| storage temp. | −20°C |
| solubility | water: soluble0.5g/10 mL |
| form | Solid |
| color | White to Off-White |
| Optical Rotation | [α]20/D +14.5±1.5°, c = 3.67% in H2O |
| Water Solubility | very faint turbidity |
| Usage | A pharmacological tool and potential chiral building block. It is also used as an internal standard for amino acid analysis. Also found to inhibit GABA transaminase, thus producing an elevation of GABA level, and to have an antitumor activity in v |
| BRN | 5763078 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C4H10N2O2.2ClH/c5-2-1-3(6)4(7)8;;/h3H,1-2,5-6H2,(H,7,8);2*1H |
| InChIKey | CKAAWCHIBBNLOJ-UHFFFAOYSA-N |
| SMILES | C(N)(C(=O)O)CCN.Cl.Cl |
| CAS DataBase Reference | 1883-09-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |