82121-05-9
| Name | 7-Methoxy-4-quinolinol |
| CAS | 82121-05-9 |
| EINECS(EC#) | 625-361-7 |
| Molecular Formula | C10H9NO2 |
| MDL Number | MFCD00169015 |
| Molecular Weight | 175.18 |
| MOL File | 82121-05-9.mol |
Chemical Properties
| Melting point | 75-77 |
| Boiling point | 351.8±22.0 °C(Predicted) |
| density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.16±0.40(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C10H9NO2/c1-13-7-2-3-8-9(6-7)11-5-4-10(8)12/h2-6H,1H3,(H,11,12) |
| InChIKey | NQUPXNZWBGZRQX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(OC)C=2)C(O)=CC=1 |
| CAS DataBase Reference | 82121-05-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |