81029-05-2
| Name | Brilliant Cresyl Blue |
| CAS | 81029-05-2 |
| EINECS(EC#) | 279-675-0 |
| Molecular Formula | C34H42Cl4N8O2Zn |
| MDL Number | MFCD00148902 |
| Molecular Weight | 801.95 |
| MOL File | 81029-05-2.mol |
Chemical Properties
| Appearance | deep green to dark blue crystalline powder |
| Melting point | 233-236 °C(lit.) |
| Boiling point | 78 °C |
| density | 0.808 |
| Fp | 15 °C |
| storage temp. | Store at +15°C to +30°C. |
| solubility | DMSO (Slghtly), Ethanol (Slightly), Water (Slightly) |
| Colour Index | 51010 |
| form | Crystalline Powder |
| pka | 6.0, 11.0(at 25℃) |
| color | White to off-white |
| Odor | Odorless |
| PH Range | 3.7 at 20°C |
| BRN | 5690713 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C17H21N4O.4ClH.Zn/c1-4-21(5-2)11-6-7-14-15(8-11)22-17-10(3)12(18)9-13(19)16(17)20-14;;;;;/h6-9H,4-5,18-19H2,1-3H3;4*1H;/q+1;;;;;+2/p-4 |
| InChIKey | MJQMEHNJPRMZLG-UHFFFAOYSA-J |
| SMILES | [Zn+2]([Cl-])([Cl-])([Cl-])[Cl-].NC1=CC(N)=C(C)C2=[O+]C3=CC(N(CC)CC)=CC=C3N=C12 |