81-21-0
| Name | Dicyclopentadiene diepoxide |
| CAS | 81-21-0 |
| EINECS(EC#) | 201-334-1 |
| Molecular Formula | C10H12O2 |
| MDL Number | MFCD00077209 |
| Molecular Weight | 164.2 |
| MOL File | 81-21-0.mol |
Chemical Properties
| Appearance | white to yellow-beige crystals or |
| Melting point | 185-189 °C(lit.) |
| Boiling point | 120°C 10mm |
| density | 1,331 g/cm3 |
| refractive index | 1.5460 (estimate) |
| Fp | 120°C/10mm subl. |
| storage temp. | Sealed in dry,2-8°C |
| form | Crystals or Crystalline Powder |
| color | White to yellow-beige |
| Water Solubility | Soluble in water. |
| BRN | 112743 |
| InChI | InChI=1S/C10H12O2/c1-4-3-2-6-10(11-6)7(3)5(1)9-8(4)12-9/h3-10H,1-2H2 |
| InChIKey | BQQUFAMSJAKLNB-UHFFFAOYSA-N |
| SMILES | O1C2CC3C(C12)C1CC3C2C1O2 |
| CAS DataBase Reference | 81-21-0(CAS DataBase Reference) |
| EPA Substance Registry System | 81-21-0(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P280f-P309-P310-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | PB9625200 |
| TSCA | Yes |
| HazardClass | 6.1 |
| HS Code | 29109000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| Hazardous Substances Data | 81-21-0(Hazardous Substances Data) |
| Toxicity |
