
79917-90-1
| Name | 1-Butyl-3-methylimidazolium chloride |
| CAS | 79917-90-1 |
| EINECS(EC#) | 460-120-8 |
| Molecular Formula | C8H15ClN2 |
| MDL Number | MFCD03095425 |
| Molecular Weight | 174.67 |
| MOL File | 79917-90-1.mol |
Chemical Properties
| Appearance | cream-colored to yellow mass |
| Melting point | ~70 °C |
| density | d25 1.08 (dried) |
| Fp | 192 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Mass |
| color | Cream to yellow |
| Water Solubility | Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, |
| Sensitive | Hygroscopic |
| Detection Methods | T,NMR |
| BRN | 6449277 |
| Stability: | hygroscopic |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.[Cl-] |
| CAS DataBase Reference | 79917-90-1(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen;Moisture sensitive |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 3-10-21 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |

