
79815-20-6
| Name | (S)-(-)-Indoline-2-carboxylic acid |
| CAS | 79815-20-6 |
| EINECS(EC#) | 410-860-2 |
| Molecular Formula | C9H9NO2 |
| MDL Number | MFCD00792496 |
| Molecular Weight | 163.17 |
| MOL File | 79815-20-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 177 °C (dec.)(lit.) |
| alpha | -112.5 º (c=1, 1N HCl) |
| Boiling point | 290.25°C (rough estimate) |
| density | 1.2021 (rough estimate) |
| refractive index | -116 ° (C=1, 2mol/L HCl) |
| storage temp. | Store at 0°C |
| Water Solubility | Slightly soluble in water |
| form | Powder |
| pka | 2.04±0.20(Predicted) |
| color | Beige to brown |
| Optical Rotation | [α]20/D 114°, c = 1 in 1 M HCl |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | QNRXNRGSOJZINA-QMMMGPOBSA-N |
| SMILES | N1C2=C(C=CC=C2)C[C@H]1C(O)=O |
| CAS DataBase Reference | 79815-20-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H361fd-H373 |
| Precautionary statements | P202-P260-P272-P280-P302+P352-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| REACH Registrations | Active |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 Skin Sens. 1 STOT RE 2 |

