784-38-3
| Name | 2-Amino-5-chloro-2'-fluorobenzophenone |
| CAS | 784-38-3 |
| EINECS(EC#) | 212-316-8 |
| Molecular Formula | C13H9ClFNO |
| MDL Number | MFCD00038381 |
| Molecular Weight | 249.67 |
| MOL File | 784-38-3.mol |
Chemical Properties
| Appearance | YELLOW FINE POWDER |
| Melting point | 95-98 °C(lit.) |
| Boiling point | 207C |
| density | 1.3134 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.05±0.10(Predicted) |
| color | Yellow |
| Usage | A starting material for the synthesis of diazepam and other benzodiazepines |
| InChI | InChI=1S/C13H9ClFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| InChIKey | GTGMXPIQRQSORU-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Cl)=CC=C1N)(C1=CC=CC=C1F)=O |
| CAS DataBase Reference | 784-38-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-amino-5-chlorophenyl)(2-fluorophenyl)-(784-38-3) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |