345-92-6
| Name | Bis(4-fluorophenyl)-methanone |
| CAS | 345-92-6 |
| EINECS(EC#) | 206-466-3 |
| Molecular Formula | C13H8F2O |
| MDL Number | MFCD00000353 |
| Molecular Weight | 218.2 |
| MOL File | 345-92-6.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline powder |
| Melting point | 102-105 °C (lit.) |
| Boiling point | 137°C (3 torr) |
| density | 1.2543 (estimate) |
| vapor pressure | 0.005Pa at 20℃ |
| Fp | 170-172°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble in water |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | 8.757mg/L at 20℃ |
| BRN | 516231 |
| InChI | 1S/C13H8F2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1)C(=O)c2ccc(F)cc2 |
| LogP | 3.37 at 20℃ |
| CAS DataBase Reference | 345-92-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Difluorobenzophenone(345-92-6) |
| EPA Substance Registry System | 4,4'-Difluorobenzophenone (345-92-6) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H411 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | DJ0685000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |