
78-73-9
| Name | Choline bicarbonate |
| CAS | 78-73-9 |
| EINECS(EC#) | 201-137-0 |
| Molecular Formula | C6H15NO4 |
| MDL Number | MFCD00031689 |
| Molecular Weight | 165.19 |
| MOL File | 78-73-9.mol |
Chemical Properties
| Appearance | Colorless liquid.Miscible with water. |
| density | 1.152 g/mL at 25 °C |
| vapor pressure | 23.904hPa at 25℃ |
| refractive index | n |
| storage temp. | 2-8°C |
| solubility | Methanol (Sparingly), Water (Soluble) |
| form | Colourless Solution |
| Water Solubility | 750g/L at 20℃ |
| InChI | InChI=1S/C5H14NO.CH2O3/c1-6(2,3)4-5-7;2-1(3)4/h7H,4-5H2,1-3H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | DQKGOGJIOHUEGK-UHFFFAOYSA-M |
| SMILES | C(CO)[N+](C)(C)C.C(O)([O-])=O |
| Uses | |
| CAS DataBase Reference | 78-73-9(CAS DataBase Reference) |
| EPA Substance Registry System | Choline carbonate (1:1) (78-73-9) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![Chemical reactions in the synthesis of [1CA:3PE]. Chemical reactions in the synthesis of [1CA:3PE].](/NewsImg/2024-04-22/6384939942527863577745004.png)