779-27-1
| Name | 7-HYDROXYCOUMARIN-3-CARBOXYLIC ACID |
| CAS | 779-27-1 |
| EINECS(EC#) | 1415-596-9 |
| Molecular Formula | C10H6O5 |
| MDL Number | MFCD00017491 |
| Molecular Weight | 206.15 |
| MOL File | 779-27-1.mol |
Chemical Properties
| Melting point | 261 °C(lit.) |
| Boiling point | 474.8±45.0 °C(Predicted) |
| density | 1.639±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.04 ± 0.02, temperature: 23 °C |
| color | Yellow solid;Orange solid; Off-white powder |
| λmax | 386 nm (Buffer pH 10.0); 339 nm (Buffer pH 4.0) |
| BRN | 384141 |
| Biological Applications | Chemical dosimeter for radiation therapy; detecting bacteria; detecting/sensing hydroxyl radicals; studying nucleic acids; as a substrate for measuring carboxylesterases activity, cellulases activity, β-galactosidases activity, glycosidases activity, glycosyltransferases activity, hydrolases activity, 4-hydroxycinnamate decarboxylases activity, β-lactamases activity, phosphatases activity, sulfatases activity; treating cancer/antitumor activity |
| Major Application | Carbon-dioxide sensor; chemical sensors based on non-linear optics; monitoring of cationic photopolymerization processes; nanomaterials |
| InChI | InChI=1S/C10H6O5/c11-6-2-1-5-3-7(9(12)13)10(14)15-8(5)4-6/h1-4,11H,(H,12,13) |
| InChIKey | LKLWLDOUZJEHDY-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C=C1C(O)=O |
