72-55-9
| Name | 4,4'-DDE |
| CAS | 72-55-9 |
| EINECS(EC#) | 200-784-6 |
| Molecular Formula | C14H8Cl4 |
| MDL Number | MFCD00000837 |
| Molecular Weight | 318.03 |
| MOL File | 72-55-9.mol |
Chemical Properties
| Appearance | white crystalline powder |
| Melting point | 88-90 °C(lit.) |
| Boiling point | 403.45°C (rough estimate) |
| density | 1.3406 (rough estimate) |
| vapor pressure | 13 at 30 °C (Wescott et al., 1981) |
| refractive index | 1.6000 (estimate) |
| Fp | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | ethanol: soluble |
| form | neat |
| color | White, crystalline, odorless powder |
| Stability: | Stable, but light-sensitive. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility | 292mg/L(25 ºC) |
| BRN | 1913355 |
| Henry's Law Constant | 0.33 at 25 °C (gas stripping-GC, Jantunen and Bidleman, 2006) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | UCNVFOCBFJOQAL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)\C(=C(/Cl)Cl)c2ccc(Cl)cc2 |
Safety Data
| Hazard Codes | Xn,N,T,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | KV9450000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 STOT RE 1 Oral |
| Hazardous Substances Data | 72-55-9(Hazardous Substances Data) |
| Toxicity |