
696-07-1
| Name | 5-Iodouracil |
| CAS | 696-07-1 |
| EINECS(EC#) | 211-788-2 |
| Molecular Formula | C4H3IN2O2 |
| MDL Number | MFCD00006020 |
| Molecular Weight | 237.98 |
| MOL File | 696-07-1.mol |
Chemical Properties
| Appearance | white to light yellow fluffy powder |
| Melting point | 274-276 °C (dec.) (lit.) |
| density | 2.2076 (estimate) |
| storage temp. | 0-6°C |
| solubility | Very faint turbidity in NH3aq. Soluble in 1M NaOH. |
| form | Fluffy Powder |
| pka | 7.02±0.10(Predicted) |
| color | White to light yellow |
| Water Solubility | SOLUBLE IN COLD WATER |
| Sensitive | Light Sensitive |
| Detection Methods | HPLC |
| BRN | 4891 |
| InChI | InChI=1S/C4H3IN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | KSNXJLQDQOIRIP-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(I)C(=O)N1 |
| CAS DataBase Reference | 696-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Iodouracil(696-07-1) |
| Storage Precautions | Light sensitive |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 5-iodo- (696-07-1) |
Safety Data
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | YR0525000 |
| Hazard Note | Irritant/Carcinogenic/Light Sensitive |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |