68682-02-0
| Name | (+/-)-8-PRENYLNARINGENIN |
| CAS | 68682-02-0 |
| EINECS(EC#) | 245-096-7 |
| Molecular Formula | C20H20O5 |
| MDL Number | MFCD21364781 |
| Molecular Weight | 340.37 |
| MOL File | 68682-02-0.mol |
Chemical Properties
| Melting point | 183-184 °C |
| Boiling point | 597.6±50.0 °C(Predicted) |
| density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Light yellow powder |
| pka | 7.70±0.40(Predicted) |
| color | Off-White to Pale Yellow |
| Stability: | Light Sensitive |
| Major Application | food and beverages |
| InChI | 1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/t18-/m0/s1 |
| InChIKey | LPEPZZAVFJPLNZ-SFHVURJKSA-N |
| SMILES | OC1=C(C(CC(C2=CC=C(O)C=C2)O3)=O)C3=C(CC=C(C)C)C(O)=C1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P280-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |