67531-86-6
| Name | 2-Fluoro-6-hydroxybenzoic acid |
| CAS | 67531-86-6 |
| EINECS(EC#) | 627-357-0 |
| Molecular Formula | C7H5FO3 |
| MDL Number | MFCD00052179 |
| Molecular Weight | 156.11 |
| MOL File | 67531-86-6.mol |
Chemical Properties
| Appearance | White to tan powder |
| Melting point | 159-163 °C (lit.) |
| Boiling point | 291.2±25.0 °C(Predicted) |
| density | 1.492±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.68±0.25(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 7111497 |
| InChI | InChI=1S/C7H5FO3/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | BCEKGWWLVKXZKK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(O)C=CC=C1F |
| CAS DataBase Reference | 67531-86-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29181990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |