668-45-1
| Name | 2-Chloro-6-fluorobenzonitrile |
| CAS | 668-45-1 |
| EINECS(EC#) | 211-571-2 |
| Molecular Formula | C7H3ClFN |
| MDL Number | MFCD00001780 |
| Molecular Weight | 155.56 |
| MOL File | 668-45-1.mol |
Chemical Properties
| Appearance | colourless to light beige crystals, crystalline |
| Melting point | 55-59 °C(lit.) |
| Boiling point | 104 °C11 mm Hg(lit.) |
| density | 1.3760 (estimate) |
| Fp | 104-105°C/11mm |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1940332 |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 668-45-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H302-H311-H332-H301+H311+H331 |
| Precautionary statements | P280h-P309-P310-P264-P270-P271-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
;