65283-60-5
| Name | (R)-(-)-6,6'-Dibromo-1,1'-bi-2-naphthol |
| CAS | 65283-60-5 |
| Molecular Formula | C20H12Br2O2 |
| MDL Number | MFCD00798290 |
| Molecular Weight | 444.12 |
| MOL File | 65283-60-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 195-199 °C(lit.) |
| alpha | -48 º (c=1.8, THF) |
| Boiling point | 546.2±45.0 °C(Predicted) |
| density | 1.5428 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 7.78±0.50(Predicted) |
| color | White to Light yellow to Light orange |
| Optical Rotation | [α]20/D 49°, c = 1.8 in acetic acid |
| InChI | 1S/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H |
| InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(c(c(cc2)O)c3c4c(cc(cc4)Br)ccc3O)cc1 |
| CAS DataBase Reference | 65283-60-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
;