
65162-13-2
| Name | 1-Methoxy-5-methylphenazinium methyl sulfate |
| CAS | 65162-13-2 |
| EINECS(EC#) | 265-579-6 |
| Molecular Formula | C15H16N2O5S |
| MDL Number | MFCD00040648 |
| Molecular Weight | 336.36 |
| MOL File | 65162-13-2.mol |
Chemical Properties
| Melting point | 172 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water: 1 mg/ml |
| form | powder to crystal |
| color | Orange to Brown to Dark purple |
| Water Solubility | H2O: 1mg/mL, clear, red |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MASUWVVNWALEEM-UHFFFAOYSA-M |
| SMILES | S([O-])(=O)(=O)OC.O(C1=CC=CC2=[N+](C3=CC=CC=C3N=C12)C)C |
| CAS DataBase Reference | 65162-13-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H341-H351-H361d-H373 |
| Precautionary statements | P202-P260-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Muta. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 |

