65-28-1
| Name | Phentolamine mesilate |
| CAS | 65-28-1 |
| EINECS(EC#) | 200-604-6 |
| Molecular Formula | C18H23N3O4S |
| MDL Number | MFCD00134201 |
| Molecular Weight | 377.46 |
| MOL File | 65-28-1.mol |
Chemical Properties
| Appearance | Crystalline Solid |
| Melting point | 180-182 °C(lit.) |
| density | 1.2256 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | Refrigerator |
| solubility | ethanol: 26 mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | 50 mg/mL |
| Merck | 14,7264 |
| Stability: | Aq. Solutions Cannot be Stored |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| SMILES | N(CC1=NCCN1)(C1C=CC(C)=CC=1)C1C=CC=C(O)C=1.S(=O)(=O)(O)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | SL5430000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |