
64695-78-9
| Name | 1,2-Dibromo-4,5-difluorobenzene |
| CAS | 64695-78-9 |
| EINECS(EC#) | 265-021-1 |
| Molecular Formula | C6H2Br2F2 |
| MDL Number | MFCD00009890 |
| Molecular Weight | 271.88 |
| MOL File | 64695-78-9.mol |
Chemical Properties
| Appearance | white crystalline low melting mass |
| Melting point | 33-35 °C (lit.) |
| Boiling point | 216.2±35.0 °C(Predicted) |
| density | 2.1030 (rough estimate) |
| refractive index | 1.5151 (estimate) |
| Fp | 112 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Water Solubility | insoluble |
| BRN | 1941132 |
| InChI | InChI=1S/C6H2Br2F2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | JTEZQWOKRHOKDG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1Br |
| CAS DataBase Reference | 64695-78-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Dibromo-4,5-difluorobenzene(64695-78-9) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |