
634-47-9
| Name | 2-CHLOROLEPIDINE |
| CAS | 634-47-9 |
| EINECS(EC#) | 211-209-3 |
| Molecular Formula | C10H8ClN |
| MDL Number | MFCD00006742 |
| Molecular Weight | 177.63 |
| MOL File | 634-47-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 55-58 °C(lit.) |
| Boiling point | 296 °C(lit.) |
| density | 1.1810 (rough estimate) |
| refractive index | 1.6224 (estimate) |
| Fp | 296°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 0.98±0.50(Predicted) |
| color | White to Almost white |
| BRN | 118333 |
| InChI | InChI=1S/C10H8ClN/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | PFEIMKNQOIFKSW-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C)=CC=1Cl |
| CAS DataBase Reference | 634-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 2-chloro-4-methyl-(634-47-9) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
