6272-26-0
| Name | 6-Hydroxy-2,3-dihydrobenzo[b]furan-3-one |
| CAS | 6272-26-0 |
| Molecular Formula | C8H6O3 |
| MDL Number | MFCD00068174 |
| Molecular Weight | 150.13 |
| MOL File | 6272-26-0.mol |
Chemical Properties
| Melting point | 242-246 °C (dec.) (lit.) |
| Boiling point | 369.3±42.0 °C(Predicted) |
| density | 1.436±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.63±0.20(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| λmax | 319nm(MeOH)(lit.) |
| BRN | 121444 |
| InChI | InChI=1S/C8H6O3/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3,9H,4H2 |
| InChIKey | GBDMODVZBPFQKI-UHFFFAOYSA-N |
| SMILES | O1C2=CC(O)=CC=C2C(=O)C1 |
| CAS DataBase Reference | 6272-26-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |