626-00-6
| Name | 1,3-DIIODOBENZENE |
| CAS | 626-00-6 |
| EINECS(EC#) | 210-921-1 |
| Molecular Formula | C6H4I2 |
| MDL Number | MFCD00041731 |
| Molecular Weight | 329.9 |
| MOL File | 626-00-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 34-37 °C (lit.) |
| Boiling point | 285°C |
| density | 2.47 |
| refractive index | 1.7179 (estimate) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly, Heated) |
| form | Low Melting Crystalline Mass, Powder or Crystals |
| color | Yellow to beige |
| Water Solubility | Insoluble in water. Soluble in hot methanol. |
| Sensitive | Light Sensitive |
| BRN | 1904540 |
| InChI | InChI=1S/C6H4I2/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=CC(I)=C1 |
| CAS DataBase Reference | 626-00-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,3-diiodo- (626-00-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |