25416-65-3
| Name | Sodium levothyroxine |
| CAS | 25416-65-3 |
| EINECS(EC#) | 200-221-4 |
| Molecular Formula | C15H10I4NNaO4 |
| MDL Number | MFCD06408007 |
| Molecular Weight | 798.85 |
| MOL File | 25416-65-3.mol |
Chemical Properties
| Appearance | almost white to beige or |
| Melting point | 207 °C |
| alpha | 16 º (c=2,1M HCl/alcohol 1/4) |
| storage temp. | Store at 0-5°C |
| solubility | Very slightly soluble in water, slightly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| form | Liquid |
| color | Clear yellow to yellow-greenish |
| Water Solubility | 0.15 g/L (25 ºC) |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | InChI=1/C15H11I4NO4.Na/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;/h1-2,4-5,12,21H,3,20H2,(H,22,23);/q;+1/p-1/t12-;/s3 |
| InChIKey | YDTFRJLNMPSCFM-ZLBVLXFENA-M |
| SMILES | C1(=CC(=C(O)C(I)=C1)I)OC1=C(I)C=C(C[C@H](N)C([O-])=O)C=C1I.[Na+] |&1:16,r| |
| CAS DataBase Reference | 25416-65-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H372 |
| Precautionary statements | P260-P264-P270-P314-P501 |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29379000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | STOT RE 1 |