6226-25-1
| Name | 2,2,2-Trifluoroethyl trifluoromethanesulfonate |
| CAS | 6226-25-1 |
| EINECS(EC#) | 458-390-7 |
| Molecular Formula | C3H2F6O3S |
| MDL Number | MFCD00671579 |
| Molecular Weight | 232.1 |
| MOL File | 6226-25-1.mol |
Chemical Properties
| Boiling point | 89-91°C |
| density | 1,61 g/cm3 |
| refractive index | 1.3037 |
| RTECS | PB2775000 |
| Fp | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| color | Colorless to yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C3H2F6O3S/c4-2(5,6)1-12-13(10,11)3(7,8)9/h1H2 |
| InChIKey | RTMMSCJWQYWMNK-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OCC(F)(F)F)(=O)=O |
| CAS DataBase Reference | 6226-25-1(CAS DataBase Reference) |
| EPA Substance Registry System | 6226-25-1(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314-H330 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xi,T,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 8 |
| HazardClass | TOXIC, CORROSIVE |
| PackingGroup | Ⅱ |
| HS Code | 29055900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Oral Skin Corr. 1B |
