619-08-9
| Name | 2-Chloro-4-nitrophenol |
| CAS | 619-08-9 |
| EINECS(EC#) | 210-578-8 |
| Molecular Formula | C6H4ClNO3 |
| MDL Number | MFCD00043910 |
| Molecular Weight | 173.55 |
| MOL File | 619-08-9.mol |
Chemical Properties
| Appearance | white to beige crystalline powder or crystals |
| Melting point | 105-106 °C (lit.) |
| Boiling point | 290.6±25.0 °C(Predicted) |
| density | 1.4914 (rough estimate) |
| vapor pressure | 0.133Pa at 25℃ |
| refractive index | 1.5810 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder or Crystals |
| pka | 5.43±0.22(Predicted) |
| color | White to beige |
| Water Solubility | slightly soluble |
| BRN | 2046372 |
| InChI | 1S/C6H4ClNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | BOFRXDMCQRTGII-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1Cl)[N+]([O-])=O |
| LogP | 2.55 |
| CAS DataBase Reference | 619-08-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-nitrophenol(619-08-9) |
| EPA Substance Registry System | 619-08-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | SK5075000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |