615-21-4
| Name | 2-HYDRAZINOBENZOTHIAZOLE |
| CAS | 615-21-4 |
| EINECS(EC#) | 210-416-6 |
| Molecular Formula | C7H7N3S |
| MDL Number | MFCD00041849 |
| Molecular Weight | 165.22 |
| MOL File | 615-21-4.mol |
Chemical Properties
| Appearance | slightly yellow to beige-green crystalline powder |
| Melting point | 198-202 °C (lit.) |
| Boiling point | 352.4±25.0 °C(Predicted) |
| density | 1.2404 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Solubility in hot methanol almost transparent. |
| form | powder to crystal |
| pka | 2.81±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H7N3S/c8-10-7-9-5-3-1-2-4-6(5)11-7/h1-4H,8H2,(H,9,10) |
| InChIKey | JYSUYJCLUODSLN-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC=C2N=C1NN |
| CAS DataBase Reference | 615-21-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2(3H)-Benzothiazolone, hydrazone (615-21-4) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DL4725000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29342000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
