
611-09-6
| Name | 5-Nitroisatin |
| CAS | 611-09-6 |
| EINECS(EC#) | 210-252-5 |
| Molecular Formula | C8H4N2O4 |
| MDL Number | MFCD00005720 |
| Molecular Weight | 192.13 |
| MOL File | 611-09-6.mol |
Chemical Properties
| Appearance | orange-yellow to orange crystalline powder |
| Melting point | 251 °C (dec.) (lit.) |
| Boiling point | 328.09°C (rough estimate) |
| density | 1.5513 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 8.06±0.20(Predicted) |
| color | Orange-yellow to orange |
| BRN | 180223 |
| InChI | InChI=1S/C8H4N2O4/c11-7-5-3-4(10(13)14)1-2-6(5)9-8(7)12/h1-3H,(H,9,11,12) |
| InChIKey | UNMYHYODJHKLOC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 611-09-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-indole-2,3-dione, 5-nitro-(611-09-6) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | NL7970000 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |