60811-18-9
| Name | 4-Bromo-1-chloro-2-fluorobenzene |
| CAS | 60811-18-9 |
| EINECS(EC#) | 612-035-4 |
| Molecular Formula | C6H3BrClF |
| MDL Number | MFCD00042519 |
| Molecular Weight | 209.44 |
| MOL File | 60811-18-9.mol |
Chemical Properties
| Appearance | colorless to yellowish liquid |
| Boiling point | 62-64°C 9mm |
| density | 1,71 g/cm3 |
| refractive index | 1.5544-1.5564 |
| Fp | 62-64°C/9mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | INSOLUBLE |
| BRN | 2206649 |
| InChI | InChI=1S/C6H3BrClF/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | AGYWDGVTLKNTBS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 60811-18-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H227-H315 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |