
60481-51-8
| Name | 3,4-Dimethylphenylhydrazine hydrochloride |
| CAS | 60481-51-8 |
| Molecular Formula | C8H13ClN2 |
| MDL Number | MFCD00052270 |
| Molecular Weight | 172.66 |
| MOL File | 60481-51-8.mol |
Chemical Properties
| Appearance | White to pink or beige-brown powder |
| Melting point | 195-200 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Amber to Dark purple |
| Water Solubility | Soluble in water. |
| BRN | 6096060 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H12N2.ClH/c1-6-3-4-8(10-9)5-7(6)2;/h3-5,10H,9H2,1-2H3;1H |
| InChIKey | YYMIOVAEQIEPET-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(C)=C(C)C=1)N.Cl |
| CAS DataBase Reference | 60481-51-8(CAS DataBase Reference) |
| EPA Substance Registry System | 60481-51-8(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| REACH Registrations | Inactive |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
