603-48-5
| Name | Leucocrystal Violet |
| CAS | 603-48-5 |
| EINECS(EC#) | 210-043-9 |
| Molecular Formula | C25H31N3 |
| MDL Number | MFCD00008314 |
| Molecular Weight | 373.53 |
| MOL File | 603-48-5.mol |
Chemical Properties
| Appearance | lavender-coloured powder |
| Melting point | 175-177 °C(lit.) |
| Boiling point | 492.75°C (rough estimate) |
| density | 1.1857 (rough estimate) |
| vapor pressure | 0-0Pa at 10-30℃ |
| refractive index | 1.6270 (estimate) |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 5.93±0.24(Predicted) |
| color | White to light gray to slightly lavender |
| Stability: | Stable, but light and air sensitive. Incompatible with strong oxidizing agents. |
| ε(extinction coefficient) | ≥700 at 257-263nm |
| λmax | 260 nm |
| Henry's Law Constant | 6.4×104 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C25H31N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18,25H,1-6H3 |
| InChIKey | OAZWDJGLIYNYMU-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
Safety Data
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |