6006-65-1
| Name | N,N-Dimethylformamide dipropyl acetal |
| CAS | 6006-65-1 |
| EINECS(EC#) | 227-855-4 |
| Molecular Formula | C9H21NO2 |
| MDL Number | MFCD00009374 |
| Molecular Weight | 175.27 |
| MOL File | 6006-65-1.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Boiling point | 67-68 °C/14 mmHg (lit.) |
| density | 0.854 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 100 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| pka | 5.25±0.50(Predicted) |
| color | Colorless to Light yellow |
| Water Solubility | It hydrolyzes with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1098524 |
| InChI | InChI=1S/C9H21NO2/c1-5-7-11-9(10(3)4)12-8-6-2/h9H,5-8H2,1-4H3 |
| InChIKey | NSLGQFIDCADTAS-UHFFFAOYSA-N |
| SMILES | C(OCCC)(OCCC)N(C)C |
| CAS DataBase Reference | 6006-65-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N-Dimethylformamide dipropyl acetal(6006-65-1) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29225000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |