60-93-5
| Name | Quinine dihydrochloride |
| CAS | 60-93-5 |
| EINECS(EC#) | 200-493-4 |
| Molecular Formula | C20H26Cl2N2O2 |
| MDL Number | MFCD00151247 |
| Molecular Weight | 397.34 |
| MOL File | 60-93-5.mol |
Chemical Properties
| Appearance | White Solid |
| Melting point | 238-2400C |
| Stability: | Stable, but may be light sensitive. Efflorescent. Incompatible with strong oxidizing agents. |
| Usage | Primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal) |
| InChIKey | LBSFSRMTJJPTCW-QJLYHTAINA-N |
| SMILES | [C@H]([C@]1([H])C[C@@H]2CC[N@]1C[C@@H]2C=C)(C1=CC=NC2=CC=C(OC)C=C12)O.Cl |&1:0,1,4,7,9,r| |
| LogP | 3.440 (est) |
| CAS DataBase Reference | 60-93-5(CAS DataBase Reference) |
| EPA Substance Registry System | 60-93-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P363-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1544 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29392000 |
| Safety Profile |