
57297-29-7
| Name | Cyclopropane-1-carboximidamide hydrochloride |
| CAS | 57297-29-7 |
| EINECS(EC#) | 611-495-3 |
| Molecular Formula | C4H9ClN2 |
| MDL Number | MFCD00053010 |
| Molecular Weight | 120.58 |
| MOL File | 57297-29-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 123 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4507255 |
| InChI | InChI=1S/C4H8N2.ClH/c5-4(6)3-1-2-3;/h3H,1-2H2,(H3,5,6);1H |
| InChIKey | JRYOZJIRAVZGMV-UHFFFAOYSA-N |
| SMILES | C1(C(N)=N)CC1.[H]Cl |
| CAS DataBase Reference | 57297-29-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant/Hygroscopic |
| HazardClass | IRRITANT |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
