
56425-91-3
| Name | Flurprimidol |
| CAS | 56425-91-3 |
| Molecular Formula | C15H15F3N2O2 |
| MDL Number | MFCD00072512 |
| Molecular Weight | 312.29 |
| MOL File | 56425-91-3.mol |
Chemical Properties
| Appearance | White to pale yellow or buff crystalline solid. Slight aromatic odor. |
| Melting point | 94-96° |
| Boiling point | 264°C (rough estimate) |
| density | 1.2779 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 12.23±0.29(Predicted) |
| color | White to Off-White |
| BRN | 892930 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C15H15F3N2O2/c1-10(2)14(21,12-7-19-9-20-8-12)11-3-5-13(6-4-11)22-15(16,17)18/h3-10,21H,1-2H3 |
| InChIKey | VEVZCONIUDBCDC-UHFFFAOYSA-N |
| SMILES | C(C1=CN=CN=C1)(C1=CC=C(OC(F)(F)F)C=C1)(O)C(C)C |
| LogP | 3.340 |
| EPA Substance Registry System | 5-Pyrimidinemethanol, .alpha.-(1-methylethyl)-.alpha.-[ 4-(trifluoromethoxy)phenyl]- (56425-91-3) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity |