558-32-7
| Name | TETRAMETHYLAMMONIUM HEXAFLUOROPHOSPHATE |
| CAS | 558-32-7 |
| EINECS(EC#) | 209-194-3 |
| Molecular Formula | C4H12F6NP |
| MDL Number | MFCD00012012 |
| Molecular Weight | 219.11 |
| MOL File | 558-32-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | >300 °C(lit.) |
| refractive index | 1.482-1.485 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | Powder |
| color | White |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. May decompose on exposure to water or moist air. |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 3730394 |
| InChI | 1S/C4H12N.F6P/c1-5(2,3)4;1-7(2,3,4,5)6/h1-4H3;/q+1;-1 |
| InChIKey | ZFKULDQWLXAKIM-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.F[P-](F)(F)(F)(F)F |
| CAS DataBase Reference | 558-32-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BS8000000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |