
551-62-2
| Name | 1,2,3,4-Tetrafluorobenzene |
| CAS | 551-62-2 |
| EINECS(EC#) | 208-997-6 |
| Molecular Formula | C6H2F4 |
| MDL Number | MFCD00000285 |
| Molecular Weight | 150.07 |
| MOL File | 551-62-2.mol |
Chemical Properties
| Appearance | colourless liquid |
| Melting point | -42 °C (lit.) |
| Boiling point | 95 °C (lit.) |
| density | 1.4 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 69 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.400 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| BRN | 1910024 |
| InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 551-62-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2,3,4-tetrafluoro-(551-62-2) |
Safety Data
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |