548-93-6
| Name | 3-HYDROXYANTHRANILIC ACID |
| CAS | 548-93-6 |
| EINECS(EC#) | 208-962-5 |
| Molecular Formula | C7H7NO3 |
| MDL Number | MFCD00007700 |
| Molecular Weight | 153.14 |
| MOL File | 548-93-6.mol |
Chemical Properties
| Melting point | 240 °C (dec.)(lit.) |
| Boiling point | 276.03°C (rough estimate) |
| density | 1.3585 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | −20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Liquid or Low Melting Solid |
| pka | pK1: 2.5(+1);pK2: 5.192(0);pK3: 10.118(OH) (25°C) |
| color | Clear colorless to white to yellow to orange |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | WJXSWCUQABXPFS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(O)=C1N |
| CAS DataBase Reference | 548-93-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DG2625000 |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 548-93-6(Hazardous Substances Data) |