
5466-77-3
| Name | Octyl 4-methoxycinnamate |
| CAS | 5466-77-3 |
| EINECS(EC#) | 226-775-7 |
| Molecular Formula | C18H26O3 |
| MDL Number | MFCD00072582 |
| Molecular Weight | 290.4 |
| MOL File | 5466-77-3.mol |
Chemical Properties
| Appearance | colourless or pale yellow liquid |
| Melting point | <-25℃ |
| Boiling point | 198-200°C |
| density | 1.009 |
| refractive index | 1.543-1.547 |
| Fp | 193°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Odor | Odorless |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | <0.1 g/100 mL at 27 ºC |
| BRN | 5946632 |
| Cosmetics Ingredients Functions | UV ABSORBER UV FILTER LIGHT STABILIZER |
| InChI | 1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+ |
| InChIKey | YBGZDTIWKVFICR-JLHYYAGUSA-N |
| SMILES | CCCCC(CC)COC(=O)\C=C\c1ccc(OC)cc1 |
| LogP | 5.921 (est) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| Safety Statements | |
| WGK Germany | nwg |
| RTECS | UD3392732 |
| TSCA | TSCA listed |
| HS Code | 29189090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 5466-77-3(Hazardous Substances Data) |
