5434-21-9
| Name | 4-Aminophthalic acid |
| CAS | 5434-21-9 |
| EINECS(EC#) | 226-596-4 |
| Molecular Formula | C8H7NO4 |
| MDL Number | MFCD00013985 |
| Molecular Weight | 181.15 |
| MOL File | 5434-21-9.mol |
Chemical Properties
| Appearance | Beige powder |
| Melting point | 344 °C (dec.)(lit.) |
| Boiling point | 465.1±40.0 °C(Predicted) |
| density | 1.551±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 3.41±0.10(Predicted) |
| color | White to Gray to Brown |
| BRN | 2723405 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H7NO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | OXSANYRLJHSQEP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(N)C=C1C(O)=O |
| CAS DataBase Reference | 5434-21-9(CAS DataBase Reference) |
| EPA Substance Registry System | 5434-21-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
