
54-96-6
| Name | 3,4-Diaminopyridine |
| CAS | 54-96-6 |
| EINECS(EC#) | 200-220-9 |
| Molecular Formula | C5H7N3 |
| MDL Number | MFCD00006401 |
| Molecular Weight | 109.13 |
| MOL File | 54-96-6.mol |
Chemical Properties
| Appearance | brownish to brown-grey crystalline powder |
| Melting point | 216-218 °C (lit.) |
| Boiling point | 194.6°C (rough estimate) |
| density | 1.1118 (rough estimate) |
| refractive index | 1.5340 (estimate) |
| Fp | 240 °C |
| storage temp. | Store below +30°C. |
| solubility | 30g/l |
| form | Crystalline Powder |
| pka | 9.17±0.12(Predicted) |
| color | Brownish to brown-gray |
| Water Solubility | 24 g/L (20 ºC) |
| Detection Methods | HPLC |
| Merck | 14,2986 |
| BRN | 110232 |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1N |
| CAS DataBase Reference | 54-96-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330-H311-H319 |
| Precautionary statements | P260-P264-P280-P302+P352+P312-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | US7600000 |
| F | 10-23 |
| Autoignition Temperature | 480 °C |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29333999 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Acute Tox. 3 Dermal Eye Irrit. 2 |
| Toxicity |
