
536-40-3
| Name | 4-CHLOROBENZHYDRAZIDE |
| CAS | 536-40-3 |
| EINECS(EC#) | 208-632-0 |
| Molecular Formula | C7H7ClN2O |
| MDL Number | MFCD00007603 |
| Molecular Weight | 170.6 |
| MOL File | 536-40-3.mol |
Chemical Properties
| Appearance | white to light beige crystals, flakes or |
| Melting point | 162-165 °C (lit.) |
| Boiling point | 170.60°C |
| density | 1.323 |
| refractive index | 1.5618 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.09±0.10(Predicted) |
| color | White to Almost white |
| BRN | 511154 |
| InChI | InChI=1S/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | PKBGHORNUFQAAW-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 536-40-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |