51436-99-8
| Name | 4-Bromo-2-fluorotoluene |
| CAS | 51436-99-8 |
| EINECS(EC#) | 257-201-3 |
| Molecular Formula | C7H6BrF |
| MDL Number | MFCD00013551 |
| Molecular Weight | 189.02 |
| MOL File | 51436-99-8.mol |
Chemical Properties
| Appearance | colorless to light yellow liqui |
| Boiling point | 68 °C (8 mmHg) |
| density | 1.492 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 169 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.492 |
| Water Solubility | INSOLUBLE |
| BRN | 1859028 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | YZFVUQSAJMLFOZ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 51436-99-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29039900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |