4635-08-9
| Name | 5-BROMO-2,3-DIAMINOPYRIDINE, 97 |
| CAS | 4635-08-9 |
| Molecular Formula | C5H6BrN3 |
| MDL Number | MFCD01692479 |
| Molecular Weight | 188.025 |
| MOL File | 4635-08-9.mol |
Chemical Properties
| Melting point | 138-145℃ |
| Boiling point | 370.1±37.0 °C(Predicted) |
| density | 1.818±0.06 g/cm3(Predicted) |
| RTECS | US4000000 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Solid |
| pka | 7.02±0.24(Predicted) |
| color | White to off-white to yellow |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C5H6BrN3/c6-3-1-9-2-4(7)5(3)8/h1-2H,7H2,(H2,8,9) |
| InChIKey | CMFSWSZEHYPECE-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Br)C(N)=C1N |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity |