455-19-6
| Name | 4-(Trifluoromethyl)benzaldehyde |
| CAS | 455-19-6 |
| EINECS(EC#) | 207-240-7 |
| Molecular Formula | C8H5F3O |
| MDL Number | MFCD00006952 |
| Molecular Weight | 174.12 |
| MOL File | 455-19-6.mol |
Chemical Properties
| Appearance | Clear colorless to yellow liquid |
| Melting point | 1-2°C |
| Boiling point | 66-67 °C13 mm Hg(lit.) |
| density | 1.275 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 150 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 1.5g/l |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.275 |
| Water Solubility | Soluble in water. 1.5 g/L at 20°C |
| Sensitive | Air Sensitive |
| Detection Methods | GC,NMR |
| BRN | 1101680 |
| InChI | 1S/C8H5F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-5H |
| InChIKey | BEOBZEOPTQQELP-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 455-19-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | IRRITANT, AIR SENSITIVE |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |