
453-71-4
| Name | 4-Fluoro-3-nitrobenzoic acid |
| CAS | 453-71-4 |
| EINECS(EC#) | 207-221-3 |
| Molecular Formula | C7H4FNO4 |
| MDL Number | MFCD00007058 |
| Molecular Weight | 185.11 |
| MOL File | 453-71-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 123-126 °C (lit.) |
| Boiling point | 92°C 15mm |
| density | 1.5071 (estimate) |
| Fp | 92°C/15mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear, light yellow |
| form | Powder or Crystals |
| pka | 3.54±0.10(Predicted) |
| color | Light yellow to tan |
| Water Solubility | insoluble |
| BRN | 2107562 |
| InChI | InChI=1S/C7H4FNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | BOJWTAQWPVBIPG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 453-71-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-nitrobenzoic acid(453-71-4) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
