403-54-3
| Name | 3-Fluorobenzonitrile |
| CAS | 403-54-3 |
| EINECS(EC#) | 206-963-5 |
| Molecular Formula | C7H4FN |
| MDL Number | MFCD00001797 |
| Molecular Weight | 121.11 |
| MOL File | 403-54-3.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Melting point | −16 °C(lit.) |
| Boiling point | 182-183 °C753 mm Hg(lit.) |
| density | 1.133 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 154 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.133 |
| Detection Methods | GC,NMR |
| BRN | 1858941 |
| InChI | InChI=1S/C7H4FN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | JZTPKAROPNTQQV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(F)=C1 |
| CAS DataBase Reference | 403-54-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3-fluoro-(403-54-3) |
| EPA Substance Registry System | 403-54-3(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | T |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
;