394-33-2
| Name | 2-Nitro-4-fluorophenol |
| CAS | 394-33-2 |
| Molecular Formula | C6H4FNO3 |
| MDL Number | MFCD00042528 |
| Molecular Weight | 157.1 |
| MOL File | 394-33-2.mol |
Chemical Properties
| Appearance | yellow crystalline powder |
| Melting point | 75-77 °C (lit.) |
| Boiling point | 234.1±20.0 °C(Predicted) |
| density | 1.4306 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 6.76±0.14(Predicted) |
| color | Orange to Green to Amber |
| BRN | 1950412 |
| InChI | InChI=1S/C6H4FNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H |
| InChIKey | ZHRLVDHMIJDWSS-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 394-33-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-2-nitrophenol(394-33-2) |
| EPA Substance Registry System | 394-33-2(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
