445-83-0
| Name | 4-Fluoro-2-nitroanisole |
| CAS | 445-83-0 |
| Molecular Formula | C7H6FNO3 |
| MDL Number | MFCD00013375 |
| Molecular Weight | 171.13 |
| MOL File | 445-83-0.mol |
Chemical Properties
| Melting point | 62-64 °C (lit.) |
| Boiling point | 272.4±20.0 °C(Predicted) |
| density | 1.321±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/C7H6FNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| InChIKey | FWLPYISRFBKEKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(F)cc1[N+]([O-])=O |
| CAS DataBase Reference | 445-83-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
